C16H35N3O2 — CID 106806545
2-amino-5-[3-(diethylamino)propyl-ethylamino]-2-ethylpentanoic acid (PubChem CID 106806545) has the molecular formula C16H35N3O2 and a molecular weight of 301.47 g/mol. Its IUPAC name is 2-amino-5-[3-(diethylamino)propyl-ethylamino]-2-ethylpentanoic acid.
| Compound Name | 2-amino-5-[3-(diethylamino)propyl-ethylamino]-2-ethylpentanoic acid |
|---|---|
| PubChem CID | 106806545 |
| Molecular Formula | C16H35N3O2 |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.27 |
| IUPAC Name | 2-amino-5-[3-(diethylamino)propyl-ethylamino]-2-ethylpentanoic acid |
| SMILES | CCN(CC)CCCN(CC)CCCC(N)(CC)C(=O)O |
| InChI | InChI=1S/C16H35N3O2/c1-5-16(17,15(20)21)11-9-12-19(8-4)14-10-13-18(6-2)7-3/h5-14,17H2,1-4H3,(H,20,21) |
| InChIKey | OJMLGDGXVPDDLO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |