C12H25NO2S — CID 107755879
2-amino-2-ethyl-5-(3-methylbutan-2-ylsulfanyl)pentanoic acid (PubChem CID 107755879) has the molecular formula C12H25NO2S and a molecular weight of 247.40 g/mol. Its IUPAC name is 2-amino-2-ethyl-5-(3-methylbutan-2-ylsulfanyl)pentanoic acid.
| Compound Name | 2-amino-2-ethyl-5-(3-methylbutan-2-ylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 107755879 |
| Molecular Formula | C12H25NO2S |
| Molecular Weight | 247.40 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-amino-2-ethyl-5-(3-methylbutan-2-ylsulfanyl)pentanoic acid |
| SMILES | CCC(N)(CCCSC(C)C(C)C)C(=O)O |
| InChI | InChI=1S/C12H25NO2S/c1-5-12(13,11(14)15)7-6-8-16-10(4)9(2)3/h9-10H,5-8,13H2,1-4H3,(H,14,15) |
| InChIKey | ORAYWVWXKIZOFG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|