C16H33NO2S — CID 107755733
ethyl 2-methyl-5-(3-methylbutan-2-ylsulfanyl)-2-(propan-2-ylamino)pentanoate (PubChem CID 107755733) has the molecular formula C16H33NO2S and a molecular weight of 303.51 g/mol. Its IUPAC name is ethyl 2-methyl-5-(3-methylbutan-2-ylsulfanyl)-2-(propan-2-ylamino)pentanoate.
| Compound Name | ethyl 2-methyl-5-(3-methylbutan-2-ylsulfanyl)-2-(propan-2-ylamino)pentanoate |
|---|---|
| PubChem CID | 107755733 |
| Molecular Formula | C16H33NO2S |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethyl 2-methyl-5-(3-methylbutan-2-ylsulfanyl)-2-(propan-2-ylamino)pentanoate |
| SMILES | CCOC(=O)C(C)(CCCSC(C)C(C)C)NC(C)C |
| InChI | InChI=1S/C16H33NO2S/c1-8-19-15(18)16(7,17-13(4)5)10-9-11-20-14(6)12(2)3/h12-14,17H,8-11H2,1-7H3 |
| InChIKey | KDDHQXMCUJVSMX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|