C14H29NO2S — CID 107755841
methyl 2-methyl-2-(methylamino)-6-(3-methylbutan-2-ylsulfanyl)hexanoate (PubChem CID 107755841) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is methyl 2-methyl-2-(methylamino)-6-(3-methylbutan-2-ylsulfanyl)hexanoate.
| Compound Name | methyl 2-methyl-2-(methylamino)-6-(3-methylbutan-2-ylsulfanyl)hexanoate |
|---|---|
| PubChem CID | 107755841 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | methyl 2-methyl-2-(methylamino)-6-(3-methylbutan-2-ylsulfanyl)hexanoate |
| SMILES | CNC(C)(CCCCSC(C)C(C)C)C(=O)OC |
| InChI | InChI=1S/C14H29NO2S/c1-11(2)12(3)18-10-8-7-9-14(4,15-5)13(16)17-6/h11-12,15H,7-10H2,1-6H3 |
| InChIKey | CRLUEAJIMSWWDY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|