C11H23NO3S — CID 66138649
methyl 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)butanoate (PubChem CID 66138649) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is methyl 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)butanoate.
| Compound Name | methyl 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 66138649 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | methyl 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(methylamino)butanoate |
| SMILES | CNC(C)(CCSC(C)CCO)C(=O)OC |
| InChI | InChI=1S/C11H23NO3S/c1-9(5-7-13)16-8-6-11(2,12-3)10(14)15-4/h9,12-13H,5-8H2,1-4H3 |
| InChIKey | PTAKPVJHNOMZGU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |