C16H25NO3S — CID 116694773
methyl 4-(4-hydroxybutan-2-ylsulfanyl)-2-(methylamino)-2-phenylbutanoate (PubChem CID 116694773) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is methyl 4-(4-hydroxybutan-2-ylsulfanyl)-2-(methylamino)-2-phenylbutanoate.
| Compound Name | methyl 4-(4-hydroxybutan-2-ylsulfanyl)-2-(methylamino)-2-phenylbutanoate |
|---|---|
| PubChem CID | 116694773 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | methyl 4-(4-hydroxybutan-2-ylsulfanyl)-2-(methylamino)-2-phenylbutanoate |
| SMILES | CNC(CCSC(C)CCO)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C16H25NO3S/c1-13(9-11-18)21-12-10-16(17-2,15(19)20-3)14-7-5-4-6-8-14/h4-8,13,17-18H,9-12H2,1-3H3 |
| InChIKey | IZIRDWBWMFAIPS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |