C16H25NO3S — CID 66137308
3-(4-hydroxybutan-2-ylsulfanyl)-2-phenyl-2-(propylamino)propanoic acid (PubChem CID 66137308) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 3-(4-hydroxybutan-2-ylsulfanyl)-2-phenyl-2-(propylamino)propanoic acid.
| Compound Name | 3-(4-hydroxybutan-2-ylsulfanyl)-2-phenyl-2-(propylamino)propanoic acid |
|---|---|
| PubChem CID | 66137308 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-(4-hydroxybutan-2-ylsulfanyl)-2-phenyl-2-(propylamino)propanoic acid |
| SMILES | CCCNC(CSC(C)CCO)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H25NO3S/c1-3-10-17-16(15(19)20,12-21-13(2)9-11-18)14-7-5-4-6-8-14/h4-8,13,17-18H,3,9-12H2,1-2H3,(H,19,20) |
| InChIKey | DWJVHHIXKPPWRI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |