C14H19F2NO3 — CID 82007199
3-(2,2-difluoroethoxy)-2-phenyl-2-(propylamino)propanoic acid (PubChem CID 82007199) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2-phenyl-2-(propylamino)propanoic acid.
| Compound Name | 3-(2,2-difluoroethoxy)-2-phenyl-2-(propylamino)propanoic acid |
|---|---|
| PubChem CID | 82007199 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-2-phenyl-2-(propylamino)propanoic acid |
| SMILES | CCCNC(COCC(F)F)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H19F2NO3/c1-2-8-17-14(13(18)19,10-20-9-12(15)16)11-6-4-3-5-7-11/h3-7,12,17H,2,8-10H2,1H3,(H,18,19) |
| InChIKey | ZNFWMGBMZLRMEC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |