C13H17F2NO3 — CID 82007437
ethyl 2-amino-3-(2,2-difluoroethoxy)-2-phenylpropanoate (PubChem CID 82007437) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is ethyl 2-amino-3-(2,2-difluoroethoxy)-2-phenylpropanoate.
| Compound Name | ethyl 2-amino-3-(2,2-difluoroethoxy)-2-phenylpropanoate |
|---|---|
| PubChem CID | 82007437 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | ethyl 2-amino-3-(2,2-difluoroethoxy)-2-phenylpropanoate |
| SMILES | CCOC(=O)C(N)(COCC(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H17F2NO3/c1-2-19-12(17)13(16,9-18-8-11(14)15)10-6-4-3-5-7-10/h3-7,11H,2,8-9,16H2,1H3 |
| InChIKey | MAMWOWAJGIWAHN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |