C14H18F2N2O — CID 82006099
3-(2,2-difluoroethoxy)-2-phenyl-2-(propylamino)propanenitrile (PubChem CID 82006099) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2-phenyl-2-(propylamino)propanenitrile.
| Compound Name | 3-(2,2-difluoroethoxy)-2-phenyl-2-(propylamino)propanenitrile |
|---|---|
| PubChem CID | 82006099 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-2-phenyl-2-(propylamino)propanenitrile |
| SMILES | CCCNC(C#N)(COCC(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H18F2N2O/c1-2-8-18-14(10-17,11-19-9-13(15)16)12-6-4-3-5-7-12/h3-7,13,18H,2,8-9,11H2,1H3 |
| InChIKey | YSHIWJRSHOKRGT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |