C17H26N2OS — CID 116693417
4-(4-hydroxybutan-2-ylsulfanyl)-2-phenyl-2-(propan-2-ylamino)butanenitrile (PubChem CID 116693417) has the molecular formula C17H26N2OS and a molecular weight of 306.48 g/mol. Its IUPAC name is 4-(4-hydroxybutan-2-ylsulfanyl)-2-phenyl-2-(propan-2-ylamino)butanenitrile.
| Compound Name | 4-(4-hydroxybutan-2-ylsulfanyl)-2-phenyl-2-(propan-2-ylamino)butanenitrile |
|---|---|
| PubChem CID | 116693417 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 4-(4-hydroxybutan-2-ylsulfanyl)-2-phenyl-2-(propan-2-ylamino)butanenitrile |
| SMILES | CC(C)NC(C#N)(CCSC(C)CCO)c1ccccc1 |
| InChI | InChI=1S/C17H26N2OS/c1-14(2)19-17(13-18,16-7-5-4-6-8-16)10-12-21-15(3)9-11-20/h4-8,14-15,19-20H,9-12H2,1-3H3 |
| InChIKey | XTKVPDYRWHQZAS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |