C17H20N2OS — CID 107781756
3-(2-methylfuran-3-yl)sulfanyl-2-phenyl-2-(propan-2-ylamino)propanenitrile (PubChem CID 107781756) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 3-(2-methylfuran-3-yl)sulfanyl-2-phenyl-2-(propan-2-ylamino)propanenitrile.
| Compound Name | 3-(2-methylfuran-3-yl)sulfanyl-2-phenyl-2-(propan-2-ylamino)propanenitrile |
|---|---|
| PubChem CID | 107781756 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-(2-methylfuran-3-yl)sulfanyl-2-phenyl-2-(propan-2-ylamino)propanenitrile |
| SMILES | Cc1occc1SCC(C#N)(NC(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H20N2OS/c1-13(2)19-17(11-18,15-7-5-4-6-8-15)12-21-16-9-10-20-14(16)3/h4-10,13,19H,12H2,1-3H3 |
| InChIKey | HLOWQAKLCWPFLW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |