C12H25NO3S — CID 66136634
4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(propan-2-ylamino)butanoic acid (PubChem CID 66136634) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(propan-2-ylamino)butanoic acid.
| Compound Name | 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(propan-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 66136634 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(propan-2-ylamino)butanoic acid |
| SMILES | CC(C)NC(C)(CCSC(C)CCO)C(=O)O |
| InChI | InChI=1S/C12H25NO3S/c1-9(2)13-12(4,11(15)16)6-8-17-10(3)5-7-14/h9-10,13-14H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | PIYATGXWITVLEN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |