C13H27NO3S — CID 64712181
ethyl 4-(2-hydroxyethylsulfanyl)-2-methyl-2-(propan-2-ylamino)pentanoate (PubChem CID 64712181) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is ethyl 4-(2-hydroxyethylsulfanyl)-2-methyl-2-(propan-2-ylamino)pentanoate.
| Compound Name | ethyl 4-(2-hydroxyethylsulfanyl)-2-methyl-2-(propan-2-ylamino)pentanoate |
|---|---|
| PubChem CID | 64712181 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethyl 4-(2-hydroxyethylsulfanyl)-2-methyl-2-(propan-2-ylamino)pentanoate |
| SMILES | CCOC(=O)C(C)(CC(C)SCCO)NC(C)C |
| InChI | InChI=1S/C13H27NO3S/c1-6-17-12(16)13(5,14-10(2)3)9-11(4)18-8-7-15/h10-11,14-15H,6-9H2,1-5H3 |
| InChIKey | AFZBSRBZNLJYSS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |