C13H27NO3S — CID 66138640
5-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(propan-2-ylamino)pentanoic acid (PubChem CID 66138640) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 5-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 5-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 66138640 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 5-(4-hydroxybutan-2-ylsulfanyl)-2-methyl-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CC(C)NC(C)(CCCSC(C)CCO)C(=O)O |
| InChI | InChI=1S/C13H27NO3S/c1-10(2)14-13(4,12(16)17)7-5-9-18-11(3)6-8-15/h10-11,14-15H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | TVAXRZXBEZMJLA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|