C16H24ClNO2S — CID 114791822
5-[(4-chlorophenyl)methylsulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoic acid (PubChem CID 114791822) has the molecular formula C16H24ClNO2S and a molecular weight of 329.89 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylsulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 5-[(4-chlorophenyl)methylsulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 114791822 |
| Molecular Formula | C16H24ClNO2S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 5-[(4-chlorophenyl)methylsulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CC(C)NC(C)(CCCSCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H24ClNO2S/c1-12(2)18-16(3,15(19)20)9-4-10-21-11-13-5-7-14(17)8-6-13/h5-8,12,18H,4,9-11H2,1-3H3,(H,19,20) |
| InChIKey | PCYDRXKMWNQBHA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|