C18H19ClO4S — CID 70486056
4-[(4-chlorophenyl)methylsulfanyl]-2-(4-hydroxyphenoxy)-2-methylbutanoic acid (PubChem CID 70486056) has the molecular formula C18H19ClO4S and a molecular weight of 366.87 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylsulfanyl]-2-(4-hydroxyphenoxy)-2-methylbutanoic acid.
| Compound Name | 4-[(4-chlorophenyl)methylsulfanyl]-2-(4-hydroxyphenoxy)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 70486056 |
| Molecular Formula | C18H19ClO4S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-[(4-chlorophenyl)methylsulfanyl]-2-(4-hydroxyphenoxy)-2-methylbutanoic acid |
| SMILES | CC(CCSCc1ccc(Cl)cc1)(Oc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C18H19ClO4S/c1-18(17(21)22,23-16-8-6-15(20)7-9-16)10-11-24-12-13-2-4-14(19)5-3-13/h2-9,20H,10-12H2,1H3,(H,21,22) |
| InChIKey | PRHSIESNWNXEOA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|