C20H22CaCl2O6 — CID 131878857
CID 131878857 (PubChem CID 131878857) has the molecular formula C20H22CaCl2O6 and a molecular weight of 469.37 g/mol.
| Compound Name | CID 131878857 |
|---|---|
| PubChem CID | 131878857 |
| Molecular Formula | C20H22CaCl2O6 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | — |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)O.CC(C)(Oc1ccc(Cl)cc1)C(=O)O.[Ca] |
| InChI | InChI=1S/2C10H11ClO3.Ca/c2*1-10(2,9(12)13)14-8-5-3-7(11)4-6-8;/h2*3-6H,1-2H3,(H,12,13); |
| InChIKey | XNRXYEQCGSQFFF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |