C12H14F2O3 — CID 143921045
2-[4-(1,1-difluoroethyl)phenoxy]-2-methylpropanoic acid (PubChem CID 143921045) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-[4-(1,1-difluoroethyl)phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-(1,1-difluoroethyl)phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143921045 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-[4-(1,1-difluoroethyl)phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(C(C)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C12H14F2O3/c1-11(2,10(15)16)17-9-6-4-8(5-7-9)12(3,13)14/h4-7H,1-3H3,(H,15,16) |
| InChIKey | KDLGHJBVHPBPSL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |