C12H15ClO4 — CID 22041503
2-[4-(2-chloroethoxy)phenoxy]-2-methylpropanoic acid (PubChem CID 22041503) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is 2-[4-(2-chloroethoxy)phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-(2-chloroethoxy)phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 22041503 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[4-(2-chloroethoxy)phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(OCCCl)cc1)C(=O)O |
| InChI | InChI=1S/C12H15ClO4/c1-12(2,11(14)15)17-10-5-3-9(4-6-10)16-8-7-13/h3-6H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | ISTNZJLVIWUBSQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|