C20H24O8S — CID 11169347
2-methyl-2-[4-[3-(4-methylsulfonyloxyphenoxy)propoxy]phenoxy]propanoic acid (PubChem CID 11169347) has the molecular formula C20H24O8S and a molecular weight of 424.47 g/mol. Its IUPAC name is 2-methyl-2-[4-[3-(4-methylsulfonyloxyphenoxy)propoxy]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[3-(4-methylsulfonyloxyphenoxy)propoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 11169347 |
| Molecular Formula | C20H24O8S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-methyl-2-[4-[3-(4-methylsulfonyloxyphenoxy)propoxy]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1ccc(OCCCOc2ccc(OS(C)(=O)=O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H24O8S/c1-20(2,19(21)22)27-17-9-5-15(6-10-17)25-13-4-14-26-16-7-11-18(12-8-16)28-29(3,23)24/h5-12H,4,13-14H2,1-3H3,(H,21,22) |
| InChIKey | GKUVOASACULIHI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|