C20H24O7S — CID 58857341
2-methyl-2-[3-[3-(4-methylsulfonyloxyphenoxy)propyl]phenoxy]propanoic acid (PubChem CID 58857341) has the molecular formula C20H24O7S and a molecular weight of 408.47 g/mol. Its IUPAC name is 2-methyl-2-[3-[3-(4-methylsulfonyloxyphenoxy)propyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[3-[3-(4-methylsulfonyloxyphenoxy)propyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 58857341 |
| Molecular Formula | C20H24O7S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-methyl-2-[3-[3-(4-methylsulfonyloxyphenoxy)propyl]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1cccc(CCCOc2ccc(OS(C)(=O)=O)cc2)c1)C(=O)O |
| InChI | InChI=1S/C20H24O7S/c1-20(2,19(21)22)26-18-8-4-6-15(14-18)7-5-13-25-16-9-11-17(12-10-16)27-28(3,23)24/h4,6,8-12,14H,5,7,13H2,1-3H3,(H,21,22) |
| InChIKey | HMRMUOBPRCUBNP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|