C26H28O6S2 — CID 11386500
2-methyl-2-[4-[3-[4-(4-methylsulfonyloxyphenyl)phenyl]propoxy]phenyl]sulfanylpropanoic acid (PubChem CID 11386500) has the molecular formula C26H28O6S2 and a molecular weight of 500.64 g/mol. Its IUPAC name is 2-methyl-2-[4-[3-[4-(4-methylsulfonyloxyphenyl)phenyl]propoxy]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-methyl-2-[4-[3-[4-(4-methylsulfonyloxyphenyl)phenyl]propoxy]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 11386500 |
| Molecular Formula | C26H28O6S2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 2-methyl-2-[4-[3-[4-(4-methylsulfonyloxyphenyl)phenyl]propoxy]phenyl]sulfanylpropanoic acid |
| SMILES | CC(C)(Sc1ccc(OCCCc2ccc(-c3ccc(OS(C)(=O)=O)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H28O6S2/c1-26(2,25(27)28)33-24-16-14-22(15-17-24)31-18-4-5-19-6-8-20(9-7-19)21-10-12-23(13-11-21)32-34(3,29)30/h6-17H,4-5,18H2,1-3H3,(H,27,28) |
| InChIKey | WXEJZVDHCFYXDI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|