C25H27NO5S — CID 4239614
[4-[[3-methoxypropyl-(4-phenylbenzoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4239614) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is [4-[[3-methoxypropyl-(4-phenylbenzoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[3-methoxypropyl-(4-phenylbenzoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4239614 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | [4-[[3-methoxypropyl-(4-phenylbenzoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCCN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO5S/c1-30-18-6-17-26(19-20-9-15-24(16-10-20)31-32(2,28)29)25(27)23-13-11-22(12-14-23)21-7-4-3-5-8-21/h3-5,7-16H,6,17-19H2,1-2H3 |
| InChIKey | LMOGVAAIVPLFLA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|