C20H19F6NO5S — CID 3543741
[4-[[[3,5-bis(trifluoromethyl)benzoyl]-(2-methoxyethyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3543741) has the molecular formula C20H19F6NO5S and a molecular weight of 499.43 g/mol. Its IUPAC name is [4-[[[3,5-bis(trifluoromethyl)benzoyl]-(2-methoxyethyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[[3,5-bis(trifluoromethyl)benzoyl]-(2-methoxyethyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3543741 |
| Molecular Formula | C20H19F6NO5S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | [4-[[[3,5-bis(trifluoromethyl)benzoyl]-(2-methoxyethyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F6NO5S/c1-31-8-7-27(12-13-3-5-17(6-4-13)32-33(2,29)30)18(28)14-9-15(19(21,22)23)11-16(10-14)20(24,25)26/h3-6,9-11H,7-8,12H2,1-2H3 |
| InChIKey | TVSHXEWEBLVPGW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|