C23H20Cl2FNO5S — CID 3888304
[4-[[(3,5-dichlorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3888304) has the molecular formula C23H20Cl2FNO5S and a molecular weight of 512.39 g/mol. Its IUPAC name is [4-[[(3,5-dichlorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(3,5-dichlorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3888304 |
| Molecular Formula | C23H20Cl2FNO5S |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | [4-[[(3,5-dichlorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCCN(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H20Cl2FNO5S/c1-31-11-10-27(23(28)17-12-18(24)14-19(25)13-17)15-16-2-6-21(7-3-16)32-33(29,30)22-8-4-20(26)5-9-22/h2-9,12-14H,10-11,15H2,1H3 |
| InChIKey | WYLODTOTXVWXHW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|