C23H21BrFNO5S — CID 4682077
[3-[[(4-bromobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4682077) has the molecular formula C23H21BrFNO5S and a molecular weight of 522.39 g/mol. Its IUPAC name is [3-[[(4-bromobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[(4-bromobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4682077 |
| Molecular Formula | C23H21BrFNO5S |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 521.03 |
| IUPAC Name | [3-[[(4-bromobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H21BrFNO5S/c1-30-14-13-26(23(27)18-5-7-19(24)8-6-18)16-17-3-2-4-21(15-17)31-32(28,29)22-11-9-20(25)10-12-22/h2-12,15H,13-14,16H2,1H3 |
| InChIKey | URYRHBGFFBXZEQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|