C23H29FN2O5S — CID 42776085
[3-[[cyclohexylcarbamoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 42776085) has the molecular formula C23H29FN2O5S and a molecular weight of 464.56 g/mol. Its IUPAC name is [3-[[cyclohexylcarbamoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[cyclohexylcarbamoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 42776085 |
| Molecular Formula | C23H29FN2O5S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [3-[[cyclohexylcarbamoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H29FN2O5S/c1-30-15-14-26(23(27)25-20-7-3-2-4-8-20)17-18-6-5-9-21(16-18)31-32(28,29)22-12-10-19(24)11-13-22/h5-6,9-13,16,20H,2-4,7-8,14-15,17H2,1H3,(H,25,27) |
| InChIKey | BVBCPTHCXZAUPX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|