C24H32FNO5S — CID 3601772
[3-[[2-ethylhexanoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3601772) has the molecular formula C24H32FNO5S and a molecular weight of 465.59 g/mol. Its IUPAC name is [3-[[2-ethylhexanoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[2-ethylhexanoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3601772 |
| Molecular Formula | C24H32FNO5S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | [3-[[2-ethylhexanoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCCCC(CC)C(=O)N(CCOC)Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H32FNO5S/c1-4-6-9-20(5-2)24(27)26(15-16-30-3)18-19-8-7-10-22(17-19)31-32(28,29)23-13-11-21(25)12-14-23/h7-8,10-14,17,20H,4-6,9,15-16,18H2,1-3H3 |
| InChIKey | REWDBOPTPKTNDK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|