C25H35FN2O4S — CID 93019397
[4-[[2-(dimethylamino)ethyl-[(2R)-2-ethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 93019397) has the molecular formula C25H35FN2O4S and a molecular weight of 478.63 g/mol. Its IUPAC name is [4-[[2-(dimethylamino)ethyl-[(2R)-2-ethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[2-(dimethylamino)ethyl-[(2R)-2-ethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 93019397 |
| Molecular Formula | C25H35FN2O4S |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | [4-[[2-(dimethylamino)ethyl-[(2R)-2-ethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCCC[C@@H](CC)C(=O)N(CCN(C)C)Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H35FN2O4S/c1-5-7-8-21(6-2)25(29)28(18-17-27(3)4)19-20-9-13-23(14-10-20)32-33(30,31)24-15-11-22(26)12-16-24/h9-16,21H,5-8,17-19H2,1-4H3/t21-/m1/s1 |
| InChIKey | TYVWPNTZWAGDOP-OAQYLSRUSA-N |
| XLogP | 4.70 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|