C24H30FNO4S — CID 46110892
[3-[[cyclopropyl(2-ethylhexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 46110892) has the molecular formula C24H30FNO4S and a molecular weight of 447.57 g/mol. Its IUPAC name is [3-[[cyclopropyl(2-ethylhexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[cyclopropyl(2-ethylhexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46110892 |
| Molecular Formula | C24H30FNO4S |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | [3-[[cyclopropyl(2-ethylhexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCCCC(CC)C(=O)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C1CC1 |
| InChI | InChI=1S/C24H30FNO4S/c1-3-5-8-19(4-2)24(27)26(21-12-13-21)17-18-7-6-9-22(16-18)30-31(28,29)23-14-10-20(25)11-15-23/h6-7,9-11,14-16,19,21H,3-5,8,12-13,17H2,1-2H3 |
| InChIKey | LRQUPKKEXRGYQT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|