C24H30FNO5S — CID 5158736
[4-[[3-cyclopentylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5158736) has the molecular formula C24H30FNO5S and a molecular weight of 463.57 g/mol. Its IUPAC name is [4-[[3-cyclopentylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[3-cyclopentylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5158736 |
| Molecular Formula | C24H30FNO5S |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | [4-[[3-cyclopentylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCCN(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C24H30FNO5S/c1-30-17-16-26(24(27)15-8-19-4-2-3-5-19)18-20-6-11-22(12-7-20)31-32(28,29)23-13-9-21(25)10-14-23/h6-7,9-14,19H,2-5,8,15-18H2,1H3 |
| InChIKey | ORXQDAMZYIMONU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|