C26H34FNO5S — CID 5218582
[5-[[3-cyclopentylpropanoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate (PubChem CID 5218582) has the molecular formula C26H34FNO5S and a molecular weight of 491.63 g/mol. Its IUPAC name is [5-[[3-cyclopentylpropanoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate.
| Compound Name | [5-[[3-cyclopentylpropanoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5218582 |
| Molecular Formula | C26H34FNO5S |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | [5-[[3-cyclopentylpropanoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1ccc(CN(CC(C)C)C(=O)CCC2CCCC2)cc1OS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H34FNO5S/c1-19(2)17-28(26(29)15-9-20-6-4-5-7-20)18-21-8-14-24(32-3)25(16-21)33-34(30,31)23-12-10-22(27)11-13-23/h8,10-14,16,19-20H,4-7,9,15,17-18H2,1-3H3 |
| InChIKey | AUBBGPYCPMUVDV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|