C20H31NO4S — CID 5121857
[3-[[3-cyclopentylpropanoyl(2-methylpropyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 5121857) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is [3-[[3-cyclopentylpropanoyl(2-methylpropyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[3-cyclopentylpropanoyl(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 5121857 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | [3-[[3-cyclopentylpropanoyl(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(C)CN(Cc1cccc(OS(C)(=O)=O)c1)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C20H31NO4S/c1-16(2)14-21(20(22)12-11-17-7-4-5-8-17)15-18-9-6-10-19(13-18)25-26(3,23)24/h6,9-10,13,16-17H,4-5,7-8,11-12,14-15H2,1-3H3 |
| InChIKey | CPUAPTIXIUSMED-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|