C20H31NO5S — CID 4116049
[3-[[3-cyclopentylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 4116049) has the molecular formula C20H31NO5S and a molecular weight of 397.54 g/mol. Its IUPAC name is [3-[[3-cyclopentylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[3-cyclopentylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4116049 |
| Molecular Formula | C20H31NO5S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [3-[[3-cyclopentylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(CCOC)C(=O)CCC2CCCC2)c1 |
| InChI | InChI=1S/C20H31NO5S/c1-3-27(23,24)26-19-10-6-9-18(15-19)16-21(13-14-25-2)20(22)12-11-17-7-4-5-8-17/h6,9-10,15,17H,3-5,7-8,11-14,16H2,1-2H3 |
| InChIKey | UJXPJZFSYUGUPO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|