C17H27NO5S — CID 42775975
[3-[[2,2-dimethylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 42775975) has the molecular formula C17H27NO5S and a molecular weight of 357.47 g/mol. Its IUPAC name is [3-[[2,2-dimethylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[2,2-dimethylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 42775975 |
| Molecular Formula | C17H27NO5S |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [3-[[2,2-dimethylpropanoyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(CCOC)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H27NO5S/c1-6-24(20,21)23-15-9-7-8-14(12-15)13-18(10-11-22-5)16(19)17(2,3)4/h7-9,12H,6,10-11,13H2,1-5H3 |
| InChIKey | NECUONOXFXVLQB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|