C18H29NO4S — CID 42775950
[3-[[2,2-dimethylpropanoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 42775950) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is [3-[[2,2-dimethylpropanoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[2,2-dimethylpropanoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 42775950 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [3-[[2,2-dimethylpropanoyl(2-methylpropyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(CC(C)C)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29NO4S/c1-7-24(21,22)23-16-10-8-9-15(11-16)13-19(12-14(2)3)17(20)18(4,5)6/h8-11,14H,7,12-13H2,1-6H3 |
| InChIKey | RDHWADSOOJUHIU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|