C24H33NO4S — CID 7494977
[3-[[[(2S)-butan-2-yl]-(4-tert-butylbenzoyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 7494977) has the molecular formula C24H33NO4S and a molecular weight of 431.60 g/mol. Its IUPAC name is [3-[[[(2S)-butan-2-yl]-(4-tert-butylbenzoyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[[(2S)-butan-2-yl]-(4-tert-butylbenzoyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 7494977 |
| Molecular Formula | C24H33NO4S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | [3-[[[(2S)-butan-2-yl]-(4-tert-butylbenzoyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CC[C@H](C)N(Cc1cccc(OS(=O)(=O)CC)c1)C(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H33NO4S/c1-7-18(3)25(23(26)20-12-14-21(15-13-20)24(4,5)6)17-19-10-9-11-22(16-19)29-30(27,28)8-2/h9-16,18H,7-8,17H2,1-6H3/t18-/m0/s1 |
| InChIKey | UYZQOLXJCOGOFG-SFHVURJKSA-N |
| XLogP | 5.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|