C19H22ClNO4S — CID 7127160
[3-[[[(2R)-butan-2-yl]-(3-chlorobenzoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 7127160) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is [3-[[[(2R)-butan-2-yl]-(3-chlorobenzoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[[(2R)-butan-2-yl]-(3-chlorobenzoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7127160 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [3-[[[(2R)-butan-2-yl]-(3-chlorobenzoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC[C@@H](C)N(Cc1cccc(OS(C)(=O)=O)c1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClNO4S/c1-4-14(2)21(19(22)16-8-6-9-17(20)12-16)13-15-7-5-10-18(11-15)25-26(3,23)24/h5-12,14H,4,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | YJOPULZRUYMXPS-CQSZACIVSA-N |
| XLogP | 4.12 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|