C19H21Cl2NO4S — CID 5003339
[4-[[butan-2-yl-(2,4-dichlorobenzoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 5003339) has the molecular formula C19H21Cl2NO4S and a molecular weight of 430.35 g/mol. Its IUPAC name is [4-[[butan-2-yl-(2,4-dichlorobenzoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[butan-2-yl-(2,4-dichlorobenzoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 5003339 |
| Molecular Formula | C19H21Cl2NO4S |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | [4-[[butan-2-yl-(2,4-dichlorobenzoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H21Cl2NO4S/c1-4-13(2)22(19(23)17-10-7-15(20)11-18(17)21)12-14-5-8-16(9-6-14)26-27(3,24)25/h5-11,13H,4,12H2,1-3H3 |
| InChIKey | LEDPJXSUYWFRCQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|