C21H27NO6S — CID 7237088
[4-[[[(2R)-butan-2-yl]-(3,5-dimethoxybenzoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 7237088) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is [4-[[[(2R)-butan-2-yl]-(3,5-dimethoxybenzoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[[(2R)-butan-2-yl]-(3,5-dimethoxybenzoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7237088 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [4-[[[(2R)-butan-2-yl]-(3,5-dimethoxybenzoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC[C@@H](C)N(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C21H27NO6S/c1-6-15(2)22(14-16-7-9-18(10-8-16)28-29(5,24)25)21(23)17-11-19(26-3)13-20(12-17)27-4/h7-13,15H,6,14H2,1-5H3/t15-/m1/s1 |
| InChIKey | PDFKSPXDZKAIHH-OAHLLOKOSA-N |
| XLogP | 3.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|