C18H29NO4S — CID 7350069
[4-[[[(2R)-butan-2-yl]-hexanoylamino]methyl]phenyl] methanesulfonate (PubChem CID 7350069) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is [4-[[[(2R)-butan-2-yl]-hexanoylamino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[[(2R)-butan-2-yl]-hexanoylamino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7350069 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [4-[[[(2R)-butan-2-yl]-hexanoylamino]methyl]phenyl] methanesulfonate |
| SMILES | CCCCCC(=O)N(Cc1ccc(OS(C)(=O)=O)cc1)[C@H](C)CC |
| InChI | InChI=1S/C18H29NO4S/c1-5-7-8-9-18(20)19(15(3)6-2)14-16-10-12-17(13-11-16)23-24(4,21)22/h10-13,15H,5-9,14H2,1-4H3/t15-/m1/s1 |
| InChIKey | WMVJTLFURDLYLE-OAHLLOKOSA-N |
| XLogP | 3.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|