C21H35NO4S — CID 42776013
[4-[[2-methylpropyl(nonanoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 42776013) has the molecular formula C21H35NO4S and a molecular weight of 397.58 g/mol. Its IUPAC name is [4-[[2-methylpropyl(nonanoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[2-methylpropyl(nonanoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42776013 |
| Molecular Formula | C21H35NO4S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | [4-[[2-methylpropyl(nonanoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CCCCCCCCC(=O)N(Cc1ccc(OS(C)(=O)=O)cc1)CC(C)C |
| InChI | InChI=1S/C21H35NO4S/c1-5-6-7-8-9-10-11-21(23)22(16-18(2)3)17-19-12-14-20(15-13-19)26-27(4,24)25/h12-15,18H,5-11,16-17H2,1-4H3 |
| InChIKey | NMUJGYPMIGJEOR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|