C20H31NO5S — CID 7414570
[4-[[heptanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 7414570) has the molecular formula C20H31NO5S and a molecular weight of 397.54 g/mol. Its IUPAC name is [4-[[heptanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[heptanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7414570 |
| Molecular Formula | C20H31NO5S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [4-[[heptanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | CCCCCCC(=O)N(Cc1ccc(OS(C)(=O)=O)cc1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H31NO5S/c1-3-4-5-6-9-20(22)21(16-19-8-7-14-25-19)15-17-10-12-18(13-11-17)26-27(2,23)24/h10-13,19H,3-9,14-16H2,1-2H3/t19-/m1/s1 |
| InChIKey | RJZBBBZYLJNRCO-LJQANCHMSA-N |
| XLogP | 3.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|