C20H22Cl2N2O5S — CID 3340950
[4-[[(2,4-dichlorophenyl)carbamoyl-(oxolan-2-ylmethyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3340950) has the molecular formula C20H22Cl2N2O5S and a molecular weight of 473.38 g/mol. Its IUPAC name is [4-[[(2,4-dichlorophenyl)carbamoyl-(oxolan-2-ylmethyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[(2,4-dichlorophenyl)carbamoyl-(oxolan-2-ylmethyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3340950 |
| Molecular Formula | C20H22Cl2N2O5S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | [4-[[(2,4-dichlorophenyl)carbamoyl-(oxolan-2-ylmethyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(CN(CC2CCCO2)C(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O5S/c1-30(26,27)29-16-7-4-14(5-8-16)12-24(13-17-3-2-10-28-17)20(25)23-19-9-6-15(21)11-18(19)22/h4-9,11,17H,2-3,10,12-13H2,1H3,(H,23,25) |
| InChIKey | LYSSCUBAHOCPHA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|