C21H25NO6S — CID 3982068
[4-[[oxolan-2-ylmethyl-(2-phenoxyacetyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3982068) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is [4-[[oxolan-2-ylmethyl-(2-phenoxyacetyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[oxolan-2-ylmethyl-(2-phenoxyacetyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3982068 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [4-[[oxolan-2-ylmethyl-(2-phenoxyacetyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(CN(CC2CCCO2)C(=O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO6S/c1-29(24,25)28-19-11-9-17(10-12-19)14-22(15-20-8-5-13-26-20)21(23)16-27-18-6-3-2-4-7-18/h2-4,6-7,9-12,20H,5,8,13-16H2,1H3 |
| InChIKey | DUGVSXUNOUWNTL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|