C22H35NO5S — CID 7283238
[4-[[[(2S)-oxolan-2-yl]methyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] methanesulfonate (PubChem CID 7283238) has the molecular formula C22H35NO5S and a molecular weight of 425.59 g/mol. Its IUPAC name is [4-[[[(2S)-oxolan-2-yl]methyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[[(2S)-oxolan-2-yl]methyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7283238 |
| Molecular Formula | C22H35NO5S |
| Molecular Weight | 425.59 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [4-[[[(2S)-oxolan-2-yl]methyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] methanesulfonate |
| SMILES | C[C@H](CC(=O)N(Cc1ccc(OS(C)(=O)=O)cc1)C[C@@H]1CCCO1)CC(C)(C)C |
| InChI | InChI=1S/C22H35NO5S/c1-17(14-22(2,3)4)13-21(24)23(16-20-7-6-12-27-20)15-18-8-10-19(11-9-18)28-29(5,25)26/h8-11,17,20H,6-7,12-16H2,1-5H3/t17-,20+/m1/s1 |
| InChIKey | BPIVFWOTWTVPAX-XLIONFOSSA-N |
| XLogP | 3.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|