C26H29NO4S — CID 4167850
[4-[[(2,2-diphenylacetyl)-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4167850) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is [4-[[(2,2-diphenylacetyl)-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[(2,2-diphenylacetyl)-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4167850 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [4-[[(2,2-diphenylacetyl)-(2-methylpropyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO4S/c1-20(2)18-27(19-21-14-16-24(17-15-21)31-32(3,29)30)26(28)25(22-10-6-4-7-11-22)23-12-8-5-9-13-23/h4-17,20,25H,18-19H2,1-3H3 |
| InChIKey | QYOAEELTACJRDT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|