C25H27NO4S — CID 4054762
[4-[[2-methylpropyl-(4-phenylbenzoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4054762) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is [4-[[2-methylpropyl-(4-phenylbenzoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[2-methylpropyl-(4-phenylbenzoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4054762 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | [4-[[2-methylpropyl-(4-phenylbenzoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO4S/c1-19(2)17-26(18-20-9-15-24(16-10-20)30-31(3,28)29)25(27)23-13-11-22(12-14-23)21-7-5-4-6-8-21/h4-16,19H,17-18H2,1-3H3 |
| InChIKey | GYRYXSNYSHBZIO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|