C20H23Cl2NO4S — CID 4530183
[4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4530183) has the molecular formula C20H23Cl2NO4S and a molecular weight of 444.38 g/mol. Its IUPAC name is [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4530183 |
| Molecular Formula | C20H23Cl2NO4S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(C)CCN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H23Cl2NO4S/c1-14(2)8-9-23(20(24)16-10-17(21)12-18(22)11-16)13-15-4-6-19(7-5-15)27-28(3,25)26/h4-7,10-12,14H,8-9,13H2,1-3H3 |
| InChIKey | HSTYFPQCSJEOHR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|