About [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate
[4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4530183) has the molecular formula C20H23Cl2NO4S
and a molecular weight of 444.38 g/mol. Its IUPAC name is [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate.
Molecular Properties
| Compound Name | [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate |
| PubChem CID | 4530183 |
| Molecular Formula | C20H23Cl2NO4S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(C)CCN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H23Cl2NO4S/c1-14(2)8-9-23(20(24)16-10-17(21)12-18(22)11-16)13-15-4-6-19(7-5-15)27-28(3,25)26/h4-7,10-12,14H,8-9,13H2,1-3H3 |
| InChIKey | HSTYFPQCSJEOHR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate?
The IUPAC name of [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate (CID 4530183) is [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate.
What is the SMILES notation for [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate?
The canonical SMILES for [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate is CC(C)CCN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate?
The InChIKey is HSTYFPQCSJEOHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23Cl2NO4S/c1-14(2)8-9-23(20(24)16-10-17(21)12-18(22)11-16)13-15-4-6-19(7-5-15)27-28(3,25)26/h4-7,10-12,14H,8-9,13H2,1-3H3.
What are the key properties of [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate?
[4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate has a molecular weight of 444.38 g/mol, XLogP of 5.02, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(3,5-dichlorobenzoyl)-(3-methylbutyl)amino]methyl]phenyl] methanesulfonate is sourced from PubChem (CID 4530183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).